CymitQuimica logo

CAS 31018-48-1

:

1-[2-(β-D-Glucopyranosyloxy)-4,6-dihydroxyphenyl]-3-phenyl-1-propanone

Description:
1-[2-(β-D-Glucopyranosyloxy)-4,6-dihydroxyphenyl]-3-phenyl-1-propanone, with the CAS number 31018-48-1, is a chemical compound that features a complex structure characterized by the presence of a glucopyranosyl moiety, which is a sugar derivative, linked to a phenolic compound. This compound exhibits properties typical of phenolic compounds, including potential antioxidant activity due to the presence of hydroxyl groups. The glucopyranosyl group may enhance its solubility in water and influence its biological activity, making it of interest in various fields such as medicinal chemistry and natural product research. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including glycosylation and redox reactions. Additionally, its structural complexity may contribute to unique interactions with biological targets, potentially leading to applications in pharmaceuticals or nutraceuticals. Overall, this compound exemplifies the intersection of carbohydrate chemistry and phenolic chemistry, highlighting the importance of glycosylated compounds in biological systems.
Formula:C21H24O9
InChI:InChI=1S/C21H24O9/c22-10-16-18(26)19(27)20(28)21(30-16)29-15-9-12(23)8-14(25)17(15)13(24)7-6-11-4-2-1-3-5-11/h1-5,8-9,16,18-23,25-28H,6-7,10H2/t16-,18-,19+,20-,21-/m1/s1
InChI key:InChIKey=NLGUKXQDDTZCDG-QNDFHXLGSA-N
SMILES:C(CCC1=CC=CC=C1)(=O)C2=C(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C=C(O)C=C2O
Synonyms:
  • 1-[2-(β-D-Glucopyranosyloxy)-4,6-dihydroxyphenyl]-3-phenyl-1-propanone
  • 2-Hydrocinnamoyl-3,5-dihydroxyphenyl β-D-glucopyranoside
  • 1-Propanone, 1-[2-(β-D-glucopyranosyloxy)-4,6-dihydroxyphenyl]-3-phenyl-
Found 2 products.