CAS 31045-09-7

Ethyl 2-methyl-1-oxaspiro[2.5]octane-2-carboxylate

Description:

Ethyl 2-methyl-1-oxaspiro[2.5]octane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which consists of a fused ring system that contributes to its distinctive properties. This compound features an ethyl ester functional group, which typically enhances its solubility in organic solvents and may influence its reactivity. The presence of the oxaspiro moiety indicates that it contains an oxygen atom within the spiro structure, potentially affecting its chemical behavior and interactions. Ethyl 2-methyl-1-oxaspiro[2.5]octane-2-carboxylate may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the synthesis of more complex organic molecules. Additionally, the compound's stability, boiling point, and melting point would depend on its specific molecular interactions and the presence of substituents. Overall, this compound represents a fascinating example of spirocyclic chemistry with potential implications in various fields, including pharmaceuticals and materials science.

Formula: C₁₁H₁₈O₃

InChI: InChI=1S/C11H18O3/c1-3-13-9(12)10(2)11(14-10)7-5-4-6-8-11/h3-8H2,1-2H3

InChI key: InChIKey=DTSQPPVGQIJERI-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1(C)C2(O1)CCCCC2

Synonyms:

• 1-Oxaspiro[2.5]octane-2-carboxylic acid, 2-methyl-, ethyl ester
• Ethyl 2-methyl-1-oxaspiro[2.5]octane-2-carboxylate

1-Oxaspiro[2.5]octane-2-carboxylic acid, 2-methyl-, ethyl ester

CAS: 31045-09-7

Formula: C₁₁H₁₈O₃

Molecular weight: 198.2588

Ref: IN-DA003207