CAS 31059-08-2
:1H-Imidazole, 1-(methoxyacetyl)-
Description:
1H-Imidazole, 1-(methoxyacetyl)-, with the CAS number 31059-08-2, is a chemical compound that features an imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound is characterized by the presence of a methoxyacetyl group attached to the imidazole nitrogen. The methoxyacetyl moiety contributes to its potential reactivity and solubility properties. Typically, imidazole derivatives exhibit a range of biological activities, including antimicrobial and antifungal properties, making them of interest in pharmaceutical research. The compound is likely to be a solid at room temperature and may be soluble in polar organic solvents due to the presence of the methoxy group. Its molecular structure allows for various interactions, including hydrogen bonding, which can influence its behavior in biological systems. As with many imidazole derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-10-4-6(9)8-3-2-7-5-8/h2-3,5H,4H2,1H3
InChI key:FGZHEMUBCFDEDD-UHFFFAOYSA-N
SMILES:COCC(=O)N1C=CN=C1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
