CAS 31061-24-2

(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid

Description:

(2,4-Dioxo-1,3-thiazolidin-3-yl)acetic acid, with the CAS number 31061-24-2, is a heterocyclic compound featuring a thiazolidine ring. This compound is characterized by the presence of two carbonyl groups (dioxo) and a carboxylic acid functional group, which contribute to its reactivity and potential biological activity. The thiazolidine ring structure imparts unique properties, including the ability to participate in various chemical reactions such as nucleophilic substitutions and cycloadditions. The presence of the carboxylic acid group suggests that it can act as an acid, potentially forming salts or esters. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the pH and solvent conditions, which are important factors to consider in applications. Overall, (2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid represents a versatile scaffold for further chemical modifications and potential therapeutic uses.

Formula: C₅H₅NO₄S

InChI: InChI=1/C5H5NO4S/c7-3-2-11-5(10)6(3)1-4(8)9/h1-2H2,(H,8,9)

SMILES: C(C(=O)O)N1C(=O)CSC1=O

Synonyms:

• 3-Thiazolidineacetic acid, 2,4-dioxo-
• (2,4-Dioxo-1,3-thiazolidin-3-yl)acetic acid

3-Thiazolidineacetic acid, 2,4-dioxo-

CAS: 31061-24-2

Formula: C₅H₅NO₄S

Purity: 99%

Color and Shape: Solid

Molecular weight: 175.1625

Ref: IN-DA00321D

2-(2,4-Dioxothiazolidin-3-yl)acetic acid

CAS: 31061-24-2

2-(2,4-Dioxothiazolidin-3-yl)acetic acid

Purity: 99%

Molecular weight: 175.16g/mol

Ref: 54-OR72671

Epalrestat Impurity 14

CAS: 31061-24-2

Formula: C₅H₅NO₄S

Molecular weight: 175.16

Ref: 4Z-E-6021

(2,4-Dioxo-thiazolidin-3-yl)-acetic acid

CAS: 31061-24-2

Formula: C₅H₅NO₄S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 175.16

Ref: 10-F028878

(2,4-Dioxo-thiazolidin-3-yl)acetic Acid

Controlled Product

CAS: 31061-24-2

Applications (2,4-Dioxo-thiazolidin-3-yl)-acetic Acid is a useful compound for preparation of novel thiazolidinedione-​hydroxamates as Zmp1 inhibitors.
References Slachtova, V., et al.: Eur. J. Med. Chem., 185, 111812 (2020)

Formula: C₅H₅NO₄S

Color and Shape: Neat

Molecular weight: 175.16

Ref: TR-D487080

(2,4-Dioxo-thiazolidin-3-yl)-acetic acid

CAS: 31061-24-2

(2,4-Dioxo-thiazolidin-3-yl)-acetic acid is a 2,4-dioxo-thiazolidine derivative that can form adducts with dialkyl or isocyanides. The product of this reaction is a 1,3,5,7-tetrahydro-1H-[1]benzothiopyran (1).

The product of this reaction is a 1,3,5,7-tetrahydro-[1]benzothiopyran (1).

Formula: C₅H₅NO₄S

Purity: Min. 95%

Molecular weight: 175.16 g/mol

Ref: 3D-GBA06124

(2,4-Dioxo-thiazolidin-3-yl)acetic Acid

CAS: 31061-24-2

Formula: C₅H₅NO₄S

Molecular weight: 175.16

Ref: ST-EA-CP-E63015