CAS 31061-24-2
:(2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid
Description:
(2,4-Dioxo-1,3-thiazolidin-3-yl)acetic acid, with the CAS number 31061-24-2, is a heterocyclic compound featuring a thiazolidine ring. This compound is characterized by the presence of two carbonyl groups (dioxo) and a carboxylic acid functional group, which contribute to its reactivity and potential biological activity. The thiazolidine ring structure imparts unique properties, including the ability to participate in various chemical reactions such as nucleophilic substitutions and cycloadditions. The presence of the carboxylic acid group suggests that it can act as an acid, potentially forming salts or esters. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility and stability can vary depending on the pH and solvent conditions, which are important factors to consider in applications. Overall, (2,4-dioxo-1,3-thiazolidin-3-yl)acetic acid represents a versatile scaffold for further chemical modifications and potential therapeutic uses.
Formula:C5H5NO4S
InChI:InChI=1/C5H5NO4S/c7-3-2-11-5(10)6(3)1-4(8)9/h1-2H2,(H,8,9)
SMILES:C(C(=O)O)N1C(=O)CSC1=O
Synonyms:- 3-Thiazolidineacetic acid, 2,4-dioxo-
- (2,4-Dioxo-1,3-thiazolidin-3-yl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-(2,4-Dioxothiazolidin-3-yl)acetic acid
CAS:2-(2,4-Dioxothiazolidin-3-yl)acetic acidFormula:C5H5NO4SPurity:99%Color and Shape:Solid-PowderMolecular weight:175.1633-Thiazolidineacetic acid, 2,4-dioxo-
CAS:Formula:C5H5NO4SPurity:99%Color and Shape:SolidMolecular weight:175.1625(2,4-Dioxo-thiazolidin-3-yl)-acetic acid
CAS:Formula:C5H5NO4SPurity:95.0%Color and Shape:SolidMolecular weight:175.16(2,4-Dioxo-thiazolidin-3-yl)acetic Acid
CAS:Controlled ProductApplications (2,4-Dioxo-thiazolidin-3-yl)-acetic Acid is a useful compound for preparation of novel thiazolidinedione-hydroxamates as Zmp1 inhibitors.
References Slachtova, V., et al.: Eur. J. Med. Chem., 185, 111812 (2020)Formula:C5H5NO4SColor and Shape:NeatMolecular weight:175.16(2,4-Dioxo-thiazolidin-3-yl)-acetic acid
CAS:(2,4-Dioxo-thiazolidin-3-yl)-acetic acid is a 2,4-dioxo-thiazolidine derivative that can form adducts with dialkyl or isocyanides. The product of this reaction is a 1,3,5,7-tetrahydro-1H-[1]benzothiopyran (1). The product of this reaction is a 1,3,5,7-tetrahydro-[1]benzothiopyran (1).Formula:C5H5NO4SPurity:Min. 95%Molecular weight:175.16 g/mol






