CAS 31063-33-9
:ε,ψ-Carotene, (6R)-
Description:
ε,ψ-Carotene, also known by its CAS number 31063-33-9, is a carotenoid, a class of pigments found in plants that play a crucial role in photosynthesis and provide coloration. This compound is characterized by its long hydrocarbon chain, which consists of a series of conjugated double bonds, contributing to its vibrant orange-yellow color. Carotenoids like ε,ψ-Carotene are known for their antioxidant properties, which help protect cells from oxidative damage. They are also precursors to vitamin A, essential for various biological functions, including vision and immune response. ε,ψ-Carotene is typically found in certain fruits and vegetables, contributing to their nutritional value. Its stability can be influenced by factors such as light, heat, and oxygen, which can lead to degradation. In terms of solubility, carotenoids are generally soluble in organic solvents but insoluble in water. This compound is of interest in both nutritional science and food technology, as it can be used as a natural colorant and health supplement.
Formula:C40H56
InChI:InChI=1S/C40H56/c1-32(2)18-13-21-35(5)24-15-26-36(6)25-14-22-33(3)19-11-12-20-34(4)23-16-27-37(7)29-30-39-38(8)28-17-31-40(39,9)10/h11-12,14-16,18-20,22-30,39H,13,17,21,31H2,1-10H3/b12-11+,22-14+,23-16+,26-15+,30-29+,33-19+,34-20+,35-24+,36-25+,37-27+/t39-/m0/s1
InChI key:InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N
SMILES:C(=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(/CCC=C(C)C)\C)\C)\C)/C)/C)\[C@@H]1C(C)(C)CCC=C1C
Synonyms:- ε,ψ-Carotene, (6R)-
- δ-Carotene, (R)-all-trans-(+)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(6R)-δ-Carotene
CAS:(6R)-δ-Carotene is an organic compound known as a carotenoid, which is a class of pigments naturally occurring in plants and some other photosynthetic organisms. It is sourced primarily from photosynthetic systems where it plays an integral role in the absorption of light energy and protection of the photosynthetic apparatus. The mode of action of (6R)-δ-Carotene involves its ability to quench singlet oxygen and other reactive oxygen species, thus providing antioxidative defense against photooxidative stress. Additionally, it participates in the light-harvesting complex, aiding in the efficient capture and transfer of light energy during photosynthesis.Formula:C40H56Purity:Min. 95%Molecular weight:536.9 g/mol
