CymitQuimica logo

CAS 31090-12-7

:

4-Methyl-2-thioxo-3(2H)-thiazoleacetic acid

Description:
4-Methyl-2-thioxo-3(2H)-thiazoleacetic acid, with the CAS number 31090-12-7, is a heterocyclic compound featuring a thiazole ring, which is characterized by its sulfur and nitrogen atoms. This compound typically exhibits a thiazole structure that contributes to its unique chemical properties, including potential reactivity and biological activity. It is known for its thioxo group, which can influence its acidity and reactivity in various chemical reactions. The presence of the methyl group enhances its lipophilicity, potentially affecting its solubility in organic solvents. This compound may be of interest in pharmaceutical research due to its structural features that could lead to biological activity, such as antimicrobial or anti-inflammatory properties. Additionally, its derivatives may be synthesized for various applications in organic synthesis and medicinal chemistry. As with many thiazole derivatives, it is essential to handle this compound with care, considering potential toxicity and environmental impact.
Formula:C6H7NO2S2
InChI:InChI=1S/C6H7NO2S2/c1-4-3-11-6(10)7(4)2-5(8)9/h3H,2H2,1H3,(H,8,9)
InChI key:InChIKey=FVQQWSSTYVBNST-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C(C)=CSC1=S
Synonyms:
  • 4-Thiazoline-3-acetic acid, 4-methyl-2-thioxo-
  • 3(2H)-Thiazoleacetic acid, 4-methyl-2-thioxo-
  • 3-Carboxymethyl-4-methyl-4-thiazoline-2-thione
  • 2-(4-Methyl-2-thioxothiazol-3(2H)-yl)acetic acid
  • 4-Methyl-2-thioxo-3(2H)-thiazoleacetic acid
Found 2 products.