CymitQuimica logo

CAS 31114-38-2

:

α-D-Glucopyranoside, β-D-fructofuranosyl, polymer with formaldehyde and 1,3,5-triazine-2,4,6-triamine

Description:
The chemical substance known as α-D-Glucopyranoside, β-D-fructofuranosyl, polymer with formaldehyde and 1,3,5-triazine-2,4,6-triamine, identified by CAS number 31114-38-2, is a complex polysaccharide derivative. This compound features a backbone primarily composed of glucopyranoside and fructofuranosyl units, which are linked through glycosidic bonds. The incorporation of formaldehyde suggests the presence of methylene bridges that can enhance the polymer's stability and structural integrity. Additionally, the presence of 1,3,5-triazine-2,4,6-triamine introduces nitrogen-rich heterocyclic moieties, which may impart unique chemical properties, such as increased reactivity or potential for cross-linking. This polymer is likely to exhibit hydrophilic characteristics due to its sugar components, making it soluble in water and potentially useful in various applications, including pharmaceuticals, food science, and materials engineering. Its specific properties, such as molecular weight, solubility, and thermal stability, would depend on the degree of polymerization and the conditions under which it was synthesized.
Formula:(C12H22O11·C3H6N6·CH2O)x
InChI:InChI=1S/C12H22O11.C3H6N6.CH2O/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12;4-1-7-2(5)9-3(6)8-1;1-2/h4-11,13-20H,1-3H2;(H6,4,5,6,7,8,9);1H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+;;/m1../s1
InChI key:InChIKey=AEOVYGMRCHELJT-HCJAYUHRSA-N
SMILES:NC=1N=C(N)N=C(N)N1.O([C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O.C=O
Synonyms:
  • α-D-Glucopyranoside, β-D-fructofuranosyl, polymer with formaldehyde and 1,3,5-triazine-2,4,6-triamine
  • Melamine, polymer with formaldehyde and sucrose
  • Sucrose, polymer with formaldehyde and melamine
  • Formaldehyde, polymer with β-D-fructofuranosyl α-D-glucopyranoside and 1,3,5-triazine-2,4,6-triamine
  • 1,3,5-Triazine-2,4,6-triamine, polymer with formaldehyde and β-D-fructofuranosyl α-D-glucopyranoside
Found 1 products.