CAS 3112-43-4

2-(Carboxycarbonyl)-1,3-benzenedicarboxylic acid

Description:

2-(Carboxycarbonyl)-1,3-benzenedicarboxylic acid, also known as a derivative of benzenedicarboxylic acid, is an organic compound characterized by its multiple carboxylic acid functional groups. This compound features a benzene ring substituted with two carboxylic acid groups at the 1 and 3 positions, along with an additional carboxycarbonyl group at the 2 position. The presence of these functional groups contributes to its acidic properties and potential for forming hydrogen bonds, which can influence its solubility in polar solvents. The compound is typically a white to off-white solid and may exhibit moderate stability under standard conditions. Its structure allows for various chemical reactions, including esterification and amidation, making it useful in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Additionally, the compound's ability to chelate metal ions may have implications in coordination chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₆O₇

InChI: InChI=1S/C10H6O7/c11-7(10(16)17)6-4(8(12)13)2-1-3-5(6)9(14)15/h1-3H,(H,12,13)(H,14,15)(H,16,17)

InChI key: InChIKey=MKKVMUPZRDPRHL-UHFFFAOYSA-N

SMILES: C(C(O)=O)(=O)C1=C(C(O)=O)C=CC=C1C(O)=O

Synonyms:

• Phthalonic acid, 6-carboxy-
• 2-(Carboxycarbonyl)-1,3-benzenedicarboxylic acid
• 2-Oxalobenzene-1,3-dicarboxylic acid
• 1,3-Benzenedicarboxylic acid, 2-(carboxycarbonyl)-

1,3-Benzenedicarboxylic acid, 2-(carboxycarbonyl)-

CAS: 3112-43-4

Formula: C₁₀H₆O₇

Molecular weight: 238.1504

Ref: IN-DA003268