CAS 31126-81-5

Rhodium, tetrakis[μ-(propanoato-κO:κO′)]di-, (Rh-Rh)

Description:

Rhodium, tetrakis[μ-(propanoato-κO:κO′)]di-, commonly referred to as Rh-Rh, is a coordination compound featuring rhodium as the central metal. This compound is characterized by its unique structure, which includes two rhodium atoms bridged by four propanoate ligands. The propanoate groups coordinate to the rhodium centers through their oxygen atoms, forming a bimetallic complex. Rhodium itself is a transition metal known for its catalytic properties, particularly in reactions involving hydrogenation and oxidation. The presence of the propanoate ligands enhances the solubility and stability of the complex in various solvents. Additionally, the compound may exhibit interesting electronic and optical properties due to the interactions between the rhodium atoms and the ligands. Its applications can extend to catalysis in organic synthesis and materials science. As with many rhodium complexes, handling should be done with care due to potential toxicity and the need for appropriate safety measures in laboratory settings.

Formula: C₁₂H₂₀O₈Rh₂

InChI: InChI=1S/4C3H6O2.2Rh/c4*1-2-3(4)5;;/h4*2H2,1H3,(H,4,5);;/q;;;;2*+2/p-4

InChI key: InChIKey=FPZUXFCJJLUGLA-UHFFFAOYSA-J

SMILES: C(C)C=1[O-][Rh+2]234[Rh+2]([O-]C(CC)=O2)([O-]C(CC)=O3)(O=C(CC)[O-]4)O1

Synonyms:

• Rhodium, tetrakis[μ-(propanoato-κO:κO′)]di-, (Rh-Rh)
• Propanoic acid, rhodium complex
• Rhodium(II) propionate
• Rhodium, tetrakis(μ-propionato)di-, (Rh-Rh)
• Rhodium, tetrakis[μ-(propanoato-O:O′)]di-, (Rh-Rh)

Rhodium, tetrakis[μ-(propanoato-κO:κO')]di-, (Rh-Rh)

CAS: 31126-81-5

Formula: C₁₂H₂₀O₈Rh₂

Molecular weight: 498.0934

Ref: IN-DA00326L