CymitQuimica logo

CAS 311321-19-4

:

3-Amino-3-(4-isopropoxyphenyl)propanoic acid

Description:
3-Amino-3-(4-isopropoxyphenyl)propanoic acid, identified by its CAS number 311321-19-4, is an organic compound characterized by the presence of an amino group and a propanoic acid moiety. This compound features a phenyl ring substituted with an isopropoxy group, which contributes to its hydrophobic characteristics. The amino group imparts basic properties, allowing it to participate in various chemical reactions, including those typical of amino acids. The presence of the isopropoxy group enhances the compound's lipophilicity, potentially influencing its solubility and interaction with biological membranes. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. Its structural features suggest potential applications in medicinal chemistry, where modifications to the amino acid backbone can lead to derivatives with enhanced efficacy or selectivity. As with many organic compounds, its stability, reactivity, and interactions with other substances will depend on environmental conditions such as pH and temperature.
Formula:C12H17NO3
InChI:InChI=1/C12H17NO3/c1-8(2)16-10-5-3-9(4-6-10)11(13)7-12(14)15/h3-6,8,11H,7,13H2,1-2H3,(H,14,15)
InChI key:GQJOHIGVBBGCRS-UHFFFAOYSA-N
SMILES:CC(C)Oc1ccc(cc1)C(CC(=O)O)N
Synonyms:
  • (3R)-3-amino-3-[4-(propan-2-yloxy)phenyl]propanoic acid
  • (3S)-3-amino-3-[4-(propan-2-yloxy)phenyl]propanoic acid
  • 3-Amino-3-[4-(1-Methylethoxy)Phenyl]Propanoic Acid
Found 3 products.