CymitQuimica logo

CAS 31139-03-4

:

4-Cyclohexene-1,2-dicarboxylicacid, 1-methyl ester, (1R,2R)-rel-

Description:
4-Cyclohexene-1,2-dicarboxylic acid, 1-methyl ester, (1R,2R)-rel- is an organic compound characterized by its cyclohexene structure, which features a double bond within a six-membered carbon ring. This compound contains two carboxylic acid functional groups that are esterified with a methyl group, contributing to its reactivity and solubility properties. The (1R,2R)-rel- designation indicates the specific stereochemistry of the molecule, which can influence its biological activity and interactions with other substances. Typically, compounds like this may exhibit moderate polarity due to the presence of the ester and carboxylic acid groups, affecting their solubility in various solvents. Additionally, the presence of the cyclohexene ring may impart unique conformational characteristics, influencing the compound's stability and reactivity. Such compounds are often of interest in organic synthesis and may have applications in pharmaceuticals, agrochemicals, or as intermediates in chemical manufacturing. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C9H12O4
InChI:InChI=1S/C9H12O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-3,6-7H,4-5H2,1H3,(H,10,11)/t6-,7-/m1/s1
InChI key:MYYLMIDEMAPSGH-RNFRBKRXSA-N
SMILES:COC(=O)[C@@H]1CC=CC[C@H]1C(=O)O
Synonyms:
  • 4-Cyclohexene-1,2-dicarboxylicacid, monomethyl ester, trans- (8CI)
  • Nsc 292899
Found 3 products.