CymitQuimica logo

CAS 3114-30-5

:

Ethanone, 1-(3,4-dibromophenyl)-

Description:
Ethanone, 1-(3,4-dibromophenyl)-, also known as 3,4-dibromoacetophenone, is an organic compound characterized by the presence of a ketone functional group and a dibromophenyl substituent. Its molecular structure features a phenyl ring substituted with two bromine atoms at the 3 and 4 positions, attached to an ethanone (acetone) moiety. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and varying melting and boiling points, influenced by the bromine substituents. Safety considerations are important when handling this compound, as brominated compounds can pose health risks and environmental concerns. Proper storage and handling protocols should be followed to mitigate any hazards associated with its use.
Formula:C8H6Br2O
InChI:InChI=1S/C8H6Br2O/c1-5(11)6-2-3-7(9)8(10)4-6/h2-4H,1H3
InChI key:GYWFVNMZKBLMAR-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC(=C(C=C1)Br)Br
Synonyms:
  • 3,4-Dibromoacetophenone
Found 4 products.