CAS 31140-37-1

Methyl 4-[[(1-[1,1′-biphenyl]-4-yl-1-methylethoxy)carbonyl]oxy]benzoate

Description:

Methyl 4-[[(1-[1,1′-biphenyl]-4-yl-1-methylethoxy)carbonyl]oxy]benzoate, with CAS number 31140-37-1, is an organic compound characterized by its complex structure, which includes a methyl ester functional group and a biphenyl moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. Its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as an intermediate in the synthesis of more complex molecules. The presence of the biphenyl group may impart unique electronic and optical properties, making it of interest in fields such as organic electronics or photonics. Additionally, the compound may exhibit specific reactivity patterns typical of esters, such as hydrolysis under acidic or basic conditions. Overall, this compound's characteristics make it a subject of interest in various chemical research areas, although specific physical and chemical properties would need to be determined experimentally.

Formula: C₂₄H₂₂O₅

InChI: InChI=1S/C24H22O5/c1-24(2,20-13-9-18(10-14-20)17-7-5-4-6-8-17)29-23(26)28-21-15-11-19(12-16-21)22(25)27-3/h4-16H,1-3H3

InChI key: InChIKey=PXYPBZYXNPAGFW-UHFFFAOYSA-N

SMILES: C(OC(OC1=CC=C(C(OC)=O)C=C1)=O)(C)(C)C2=CC=C(C=C2)C3=CC=CC=C3

Synonyms:

• Carbonic acid, α,α-dimethyl-p-phenylbenzyl ester, ester with methyl p-hydroxybenzoate
• Methyl 4-[[(1-[1,1′-biphenyl]-4-yl-1-methylethoxy)carbonyl]oxy]benzoate
• Benzoic acid, 4-[[(1-[1,1′-biphenyl]-4-yl-1-methylethoxy)carbonyl]oxy]-, methyl ester

2-(4-Biphenylyl)-prop-2-yl 4′-methoxycarbonylphenyl carbonate

CAS: 31140-37-1

2-(4-Biphenylyl)-prop-2-yl 4′-methoxycarbonylphenyl carbonate is a mimetic of the benzodiazepine ring system that has been conjugated to a phenyl group at its 4′ position. This compound can be used in a variety of strategies, such as traceless synthesis and catalysis. It is also an electrophilic reagent which can be used in organic chemistry reactions as well as for screening, germanium chemistry, and antibody production. 2-(4-Biphenylyl)-prop-2-yl 4′-methoxycarbonylphenyl carbonate is synthesized by solid phase methods using silicon or germanium based linkers.

Formula: C₂₄H₂₂O₅

Purity: Min. 95%

Molecular weight: 390.4 g/mol

Ref: 3D-FB179380