CymitQuimica logo

CAS 31161-17-8

:

2H-Pyrrolium, 5-ethyl-3,4-dihydro-1,2-dimethyl-4,4-diphenyl-,perchlorate

Description:
2H-Pyrrolium, 5-ethyl-3,4-dihydro-1,2-dimethyl-4,4-diphenyl-, perchlorate, identified by CAS number 31161-17-8, is a chemical compound that belongs to the class of pyrrolidinium salts. This substance features a pyrrolidine ring that is substituted with ethyl, dimethyl, and diphenyl groups, contributing to its unique structural and electronic properties. The perchlorate anion associated with this compound is known for its strong oxidizing characteristics. In terms of solubility, pyrrolidinium salts typically exhibit good solubility in polar solvents, which can influence their reactivity and applications. The presence of multiple substituents on the pyrrolidine ring can impart interesting steric and electronic effects, making this compound potentially useful in various chemical applications, including organic synthesis and as a precursor in the development of ionic liquids. However, due to the perchlorate component, caution is warranted regarding its stability and handling, as perchlorates can be sensitive to heat and shock.
Formula:C20H24N・ClO4
InChI:InChI=1S/C20H24N.ClHO4/c1-4-19-20(15-16(2)21(19)3,17-11-7-5-8-12-17)18-13-9-6-10-14-18;2-1(3,4)5/h5-14,16H,4,15H2,1-3H3;(H,2,3,4,5)/q+1;/p-1
InChI key:FICCBMGBBWWZRF-UHFFFAOYSA-M
SMILES:CCC1=[N+](C(CC1(C2=CC=CC=C2)C3=CC=CC=C3)C)C.[O-]Cl(=O)(=O)=O
Found 9 products.