CymitQuimica logo

CAS 31163-12-9

:

3-pyridinecarboxylic acid, 6-chloro-2-methyl-, ethyl ester

Description:
3-Pyridinecarboxylic acid, 6-chloro-2-methyl-, ethyl ester, also known by its CAS number 31163-12-9, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position of the pyridine ring introduces specific steric and electronic effects, influencing its chemical behavior and potential applications. Typically, such compounds exhibit moderate polarity, making them soluble in organic solvents while having limited solubility in water. They may participate in various chemical reactions, including esterification and nucleophilic substitution, and can serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The compound's unique structure and functional groups may also impart biological activity, warranting further investigation into its potential uses in medicinal chemistry.
Formula:C9H10ClNO2
InChI:InChI=1/C9H10ClNO2/c1-3-13-9(12)7-4-5-8(10)11-6(7)2/h4-5H,3H2,1-2H3
InChI key:CRQYVOKBIGDOGA-UHFFFAOYSA-N
SMILES:CCOC(=O)c1ccc(Cl)nc1C
Synonyms:
  • Ethyl 6-chloro-2-methylnicotinate
Found 4 products.