CAS 3118-34-1

1-Hexanone, 1,1'-(2,4,6-trihydroxy-1,3-phenylene)bis-

Description:

1-Hexanone, 1,1'-(2,4,6-trihydroxy-1,3-phenylene)bis- is an organic compound characterized by its structure, which includes a hexanone moiety and a bis-phenolic component. This compound features a hexanone group, which is a six-carbon chain with a ketone functional group, contributing to its reactivity and potential applications as a solvent or intermediate in organic synthesis. The presence of the 2,4,6-trihydroxy-1,3-phenylene unit indicates that it has multiple hydroxyl groups, which can enhance its solubility in polar solvents and increase its potential for hydrogen bonding. This structure may also impart antioxidant properties, making it of interest in various chemical and pharmaceutical applications. Additionally, the compound's molecular weight, boiling point, and other physical properties would be influenced by the balance of hydrophobic (from the hexanone) and hydrophilic (from the hydroxyl groups) characteristics. Overall, this compound's unique structure suggests potential utility in materials science, pharmaceuticals, and as a chemical intermediate.

Formula: C₁₈H₂₆O₅

InChI: InChI=1S/C18H26O5/c1-3-5-7-9-12(19)16-14(21)11-15(22)17(18(16)23)13(20)10-8-6-4-2/h11,21-23H,3-10H2,1-2H3

InChI key: JRHOSBCIYWDGHN-UHFFFAOYSA-N

SMILES: CCCCCC(=O)C1=C(C(=C(C=C1O)O)C(=O)CCCCC)O

Hyp9

CAS: 3118-34-1

Hyp9

Formula: C₁₈H₂₆O₅

Purity: 95%

Molecular weight: 322.4

Ref: 54-OR1124607

Hyp9

CAS: 3118-34-1

Purity: 95%

Ref: IN-DA0277IU

Hyp9

CAS: 3118-34-1

Hyp9, a specific agonist for the transient receptor potential canonical 6 (TRPC6) channel, is utilized in spinal cord injury (SCI) research [1].

Formula: C₁₈H₂₆O₅

Color and Shape: Solid

Molecular weight: 322.40

Ref: TM-T75550

Hyp9

CAS: 3118-34-1

1,1'-(2,4,6-Trihydroxy-1,3-phenylene)bis(hexan-1-one)

Formula: C₁₈H₂₆O₅

Purity: 98%

Molecular weight: 322.4

Ref: IN-DG01187145

Hyp9

CAS: 3118-34-1

Hyp9 is an advanced biochemical reagent, which is derived from sustainably sourced natural compounds with a proprietary purification process. Its mode of action involves targeted binding to specific molecular sites, enabling the modulation of biochemical pathways with high precision.

Formula: C₁₈H₂₆O₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 322.4 g/mol

Ref: 3D-DAA11834