
CAS 31181-80-3
:2-Pyridinemethanol, 5-fluoro-, hydrochloride (1:1)
Description:
2-Pyridinemethanol, 5-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a hydroxymethyl group (-CH2OH) at the 2-position and a fluorine atom at the 5-position of the pyridine ring contributes to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its molecular interactions can be influenced by the electronegative fluorine atom, which can affect the compound's reactivity and binding affinity in biological systems. Additionally, the hydrochloride form can stabilize the compound and improve its handling and storage characteristics. Safety data should be consulted for handling and potential hazards associated with this substance.
Formula:C6H6FNO·ClH
InChI:InChI=1S/C6H6FNO.ClH/c7-5-1-2-6(4-9)8-3-5;/h1-3,9H,4H2;1H
InChI key:InChIKey=IYKNCNLUXFXAHE-UHFFFAOYSA-N
SMILES:C(O)C1=CC=C(F)C=N1.Cl
Synonyms:- 2-Pyridinemethanol, 5-fluoro-, hydrochloride (1:1)
- 2-Pyridinemethanol, 5-fluoro-, hydrochloride
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
