CAS 312-51-6

4-Nitro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide

Description:

4-Nitro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide, with the CAS number 312-51-6, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a nitro group and a trifluoromethyl group, contributing to its unique chemical reactivity and potential applications in pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances lipophilicity, which can influence the compound's biological activity and solubility. The sulfonamide moiety is typically associated with the inhibition of bacterial dihydropteroate synthase, making such compounds of interest in medicinal chemistry. Additionally, the nitro group can serve as a site for further chemical modifications, potentially leading to derivatives with varied biological activities. Overall, this compound exemplifies the complexity and versatility of sulfonamide derivatives in chemical synthesis and drug development.

Formula: C₁₃H₉F₃N₂O₄S

InChI: InChI=1S/C13H9F3N2O4S/c14-13(15,16)9-1-3-10(4-2-9)17-23(21,22)12-7-5-11(6-8-12)18(19)20/h1-8,17H

InChI key: InChIKey=JIHBEEHTSKTWES-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(C(F)(F)F)C=C1)(=O)(=O)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• N-(4-Trifluoromethylphenyl) 4-nitrobenzenesulfonamide
• Benzenesulfonamide, 4-nitro-N-[4-(trifluoromethyl)phenyl]-
• 4-Nitro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide

4-Nitro-N-[4-(trifluoromethyl)phenyl]benzenesulfonamide

CAS: 312-51-6

Formula: C₁₃H₉F₃N₂O₄S

Molecular weight: 346.2818

Ref: IN-DA00BIG9