CymitQuimica logo

CAS 31231-58-0

:

1-(3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine

Description:
1-(3,4-dihydro-1H-isochromen-1-yl)-N-methylmethanamine, with the CAS number 31231-58-0, is a chemical compound that features a unique structure combining an isochromenyl moiety with a N-methylmethanamine group. This compound is characterized by its bicyclic structure, which contributes to its potential biological activity. The presence of the isochromenyl group suggests that it may exhibit properties typical of flavonoids, such as antioxidant or anti-inflammatory effects. The N-methylmethanamine portion indicates that it may interact with biological systems, possibly influencing neurotransmitter pathways. In terms of solubility, compounds of this nature often exhibit moderate solubility in organic solvents, while their solubility in water can vary based on the specific functional groups present. The compound's potential applications could span pharmaceuticals, agrochemicals, or as a research tool in biochemical studies. However, detailed studies on its pharmacokinetics, toxicity, and specific biological activities would be necessary to fully understand its characteristics and potential uses.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-12-8-11-10-5-3-2-4-9(10)6-7-13-11/h2-5,11-12H,6-8H2,1H3
Synonyms:
  • 1H-2-benzopyran-1-methanamine, 3,4-dihydro-N-methyl-
Found 1 products.