CymitQuimica logo

CAS 31247-23-1

:

5,8-dioxa-2-thiaspiro[3.4]octane 2,2-dioxide

Description:
5,8-Dioxa-2-thiaspiro[3.4]octane 2,2-dioxide is a heterocyclic organic compound characterized by its unique spirocyclic structure, which incorporates both sulfur and oxygen atoms within its framework. The presence of two oxo groups (dioxides) contributes to its potential reactivity and stability, while the thioether linkage introduces distinctive chemical properties. This compound is typically colorless to pale yellow and may exhibit moderate solubility in polar solvents due to its functional groups. Its spiro structure can influence its conformational flexibility and steric interactions, making it of interest in various chemical applications, including pharmaceuticals and materials science. The compound's CAS number, 31247-23-1, allows for easy identification in chemical databases. While specific applications may vary, compounds with similar structures often serve as intermediates in organic synthesis or as building blocks in the development of more complex molecules. Further studies may be required to fully elucidate its properties and potential uses in various fields.
Formula:C5H8O4S
InChI:InChI=1/C5H8O4S/c6-10(7)3-5(4-10)8-1-2-9-5/h1-4H2
InChI key:LVBYRBVQEXEAQB-UHFFFAOYSA-N
SMILES:C1COC2(O1)CS(=O)(=O)C2
Found 2 products.