CymitQuimica logo

CAS 312534-71-7

:

Phenol, 2-iodo-4-methoxy-

Description:
Phenol, 2-iodo-4-methoxy- is an organic compound characterized by the presence of a phenolic hydroxyl group, an iodine atom, and a methoxy group attached to a benzene ring. Its molecular structure features a methoxy group (-OCH3) at the para position and an iodine atom at the ortho position relative to the hydroxyl group. This compound is typically a white to light yellow solid and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of the iodine atom can impart unique reactivity, making it useful in various chemical synthesis processes, including electrophilic substitution reactions. Additionally, the methoxy group can influence the compound's electronic properties, enhancing its reactivity and stability. Phenol derivatives like this one are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their biological activity and ability to act as intermediates in organic synthesis.
Formula:C7H7IO2
InChI:InChI=1S/C7H7IO2/c1-10-5-2-3-7(9)6(8)4-5/h2-4,9H,1H3
InChI key:QCYNENHPQYYEBD-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)O)I
Found 3 products.