CymitQuimica logo

CAS 312601-47-1

:

3-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]benzamide

Description:
3-Chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]benzamide is a chemical compound characterized by its complex structure, which includes a benzamide moiety substituted with a chloro group and a pyrazole derivative. The presence of the chloro group enhances its reactivity and may influence its biological activity. The pyrazole ring, substituted with methyl groups, contributes to the compound's potential pharmacological properties, often associated with anti-inflammatory or analgesic effects. The compound's molecular structure suggests it may engage in hydrogen bonding and other intermolecular interactions, which are critical for its solubility and stability in various solvents. Additionally, the presence of the oxoethyl group indicates potential for further chemical modifications, making it a candidate for drug development. Its CAS number, 312601-47-1, allows for easy identification in chemical databases, facilitating research and application in medicinal chemistry and related fields. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity, making it of interest in pharmaceutical research.
Formula:C14H14ClN3O2
InChI:InChI=1S/C14H14ClN3O2/c1-9-6-10(2)18(17-9)13(19)8-16-14(20)11-4-3-5-12(15)7-11/h3-7H,8H2,1-2H3,(H,16,20)
InChI key:ZHNZROFLIBUAAU-UHFFFAOYSA-N
SMILES:CC1=CC(=NN1C(=O)CNC(=O)C2=CC(=CC=C2)Cl)C
Synonyms:
  • 3-Chloro-N-(2-(3,5-dimethyl-1H-pyrazol-1-yl)-2-oxoethyl)benzamide
  • Benzamide, 3-chloro-N-[2-(3,5-dimethyl-1H-pyrazol-1-yl)-2-oxoethyl]-
  • 3-chloro-N-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]benzamide
  • WAY-320426
Found 3 products.