CymitQuimica logo

CAS 312619-40-2

:

2-[[Bis[(1R)-1-phenylethyl]amino]carbonyl]benzoic acid

Description:
2-[[Bis[(1R)-1-phenylethyl]amino]carbonyl]benzoic acid, identified by its CAS number 312619-40-2, is a complex organic compound characterized by its unique structural features. It contains a benzoic acid moiety, which contributes to its acidity and potential for forming hydrogen bonds. The presence of the bis[(1R)-1-phenylethyl]amino group indicates that it has two chiral centers, which can lead to stereoisomerism, affecting its biological activity and interactions. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic phenyl groups, while the carboxylic acid functional group enhances its solubility in polar solvents. Its potential applications may include use in pharmaceuticals or as a biochemical probe, given its structural complexity and functional groups that can participate in various chemical reactions. Additionally, the compound's chirality may influence its pharmacokinetics and pharmacodynamics, making it a subject of interest in medicinal chemistry.
Formula:C24H23NO3
InChI:InChI=1S/C24H23NO3/c1-17(19-11-5-3-6-12-19)25(18(2)20-13-7-4-8-14-20)23(26)21-15-9-10-16-22(21)24(27)28/h3-18H,1-2H3,(H,27,28)/t17-,18-/m1/s1
InChI key:InChIKey=NCYIVOVUPRJYNJ-QZTJIDSGSA-N
SMILES:N(C(=O)C1=C(C(O)=O)C=CC=C1)([C@H](C)C2=CC=CC=C2)[C@H](C)C3=CC=CC=C3
Synonyms:
  • 2-[[Bis[(1R)-1-phenylethyl]amino]carbonyl]benzoic acid
  • 312619-40-2
  • Benzoic acid, 2-[[bis[(1R)-1-phenylethyl]amino]carbonyl]-
Found 1 products.