CAS 312624-05-8

2,6-bis[(4R,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridine

Description:

2,6-bis[(4R,5R)-4-methyl-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]pyridine is a complex organic compound characterized by its unique structural features, which include a pyridine ring substituted at the 2 and 6 positions with oxazoline moieties. The oxazoline groups are derived from 4-methyl-5-phenyl-4,5-dihydro-1,3-oxazole, indicating that the compound may exhibit chirality due to the presence of stereocenters in the oxazoline units. This compound is likely to possess interesting biological activity, potentially serving as a ligand or a pharmacophore in medicinal chemistry. Its molecular structure suggests that it may engage in hydrogen bonding and π-π stacking interactions, which could influence its solubility and reactivity. Additionally, the presence of both nitrogen and oxygen heteroatoms in the structure may contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. As with many organic compounds, its stability, solubility, and reactivity would depend on the specific conditions under which it is studied.

Formula: C₂₅H₂₃N₃O₂

InChI: InChI=1/C25H23N3O2/c1-16-22(18-10-5-3-6-11-18)29-24(26-16)20-14-9-15-21(28-20)25-27-17(2)23(30-25)19-12-7-4-8-13-19/h3-17,22-23H,1-2H3/t16-,17-,22+,23+/m1/s1

InChI key: WAQJMWVRZVOTCH-AFXFGAOOSA-N

SMILES: C[C@@H]1[C@H](OC(=N1)C2=NC(=CC=C2)C3=N[C@@H]([C@H](O3)C4=CC=CC=C4)C)C5=CC=CC=C5

Synonyms:

• 312624-05-8

2,6-Bis[(4R,5R)-4-methyl-5-phenyl-2-oxazolinyl]pyridine

CAS: 312624-05-8

Formula: C₂₅H₂₃N₃O₂

Molecular weight: 397.4690

Ref: IN-DA00330W