CAS 312624-15-0

Bromotricyclo[3.3.1.13,7]dec-1-ylzinc

Description:

Bromotricyclo[3.3.1.13,7]dec-1-ylzinc is an organozinc compound characterized by its unique structure, which includes a tricyclic framework and a zinc atom coordinated to a brominated cycloalkane. This compound typically exhibits properties associated with organometallics, such as reactivity towards electrophiles and nucleophiles, making it useful in various synthetic applications, particularly in organic synthesis and catalysis. The presence of the zinc atom allows for the formation of carbon-zinc bonds, which can be leveraged in cross-coupling reactions. Additionally, the bromine substituent can serve as a leaving group, facilitating further transformations. The compound is likely to be sensitive to moisture and air, necessitating careful handling under inert conditions. Its unique structural features may also impart specific stereochemical properties, influencing its reactivity and interactions with other chemical species. Overall, Bromotricyclo[3.3.1.13,7]dec-1-ylzinc represents a valuable tool in the field of synthetic organic chemistry, particularly in the development of complex molecular architectures.

Formula: C₁₀H₁₅BrZn

InChI: InChI=1S/C10H15.BrH.Zn/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h7-9H,1-6H2;1H;/q;;+1/p-1

InChI key: InChIKey=PUGQCSQHCXILTB-UHFFFAOYSA-M

SMILES: [Zn](Br)C12CC3CC(C1)CC(C2)C3

Synonyms:

• Zinc, bromotricyclo[3.3.1.13,7]dec-1-yl-
• Bromotricyclo[3.3.1.13,7]dec-1-ylzinc
• 1-Adamantylzinc bromide

1-Adamantylzinc bromide, 0.5M in THF, packaged under Argon in resealable ChemSeal™ bottles

CAS: 312624-15-0

1-Adamantylzinc bromide is used as pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referenc

Formula: C₁₀H₁₅BrZn

Molecular weight: 280.51

Ref: 02-H58408