CymitQuimica logo

CAS 312693-09-7

:

(5-Fluoro-2-methylphenyl)iodozinc

Description:
(5-Fluoro-2-methylphenyl)iodozinc, with the CAS number 312693-09-7, is an organozinc compound characterized by the presence of a zinc atom bonded to an iodo group and a substituted aromatic ring. The compound features a fluorine atom and a methyl group attached to a phenyl ring, which influences its reactivity and solubility. Organozinc compounds are typically used in organic synthesis as nucleophiles, facilitating various reactions such as cross-coupling and carbon-carbon bond formation. The presence of the fluorine atom can enhance the electrophilic character of the compound, while the methyl group may affect steric hindrance and electronic properties. This compound is likely to be sensitive to moisture and air, necessitating careful handling and storage under inert conditions. Its applications may extend to medicinal chemistry and materials science, where it can serve as an intermediate in the synthesis of more complex molecules. As with all chemical substances, safety precautions should be observed when handling this compound due to potential hazards associated with its components.
Formula:C7H6FIZn
InChI:InChI=1/C7H6F.HI.Zn/c1-6-2-4-7(8)5-3-6;;/h2,4-5H,1H3;1H;/q;;+1/p-1/rC7H6FIZn/c1-5-2-3-6(8)4-7(5)10-9/h2-4H,1H3
InChI key:InChIKey=PRGNEWAVDWRJKY-UHFFFAOYSA-M
SMILES:[Zn](I)C1=C(C)C=CC(F)=C1
Synonyms:
  • (5-Fluoro-2-methylphenyl)iodozinc
  • Zinc, (5-fluoro-2-methylphenyl)iodo-
  • See more synonyms
Found 1 products.