CymitQuimica logo

CAS 312693-53-1

:

6-methoxyquinolin-8-amine hydrobromide (1:1)

Description:
6-Methoxyquinolin-8-amine hydrobromide is a chemical compound characterized by its quinoline structure, which features a methoxy group at the 6-position and an amino group at the 8-position of the quinoline ring. This compound is typically encountered as a hydrobromide salt, indicating that it is combined with hydrobromic acid to form a stable ionic compound. The presence of the methoxy group contributes to its solubility and potential reactivity, while the amino group can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its hydrobromide form enhances its stability and solubility in polar solvents, which is advantageous for various applications, including synthesis and biological assays. As with many quinoline derivatives, it may also possess fluorescent properties, making it useful in analytical chemistry. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C10H11BrN2O
InChI:InChI=1/C10H10N2O.BrH/c1-13-8-5-7-3-2-4-12-10(7)9(11)6-8;/h2-6H,11H2,1H3;1H
InChI key:WGYQQCWLZRGIKB-UHFFFAOYSA-N
SMILES:COC1=CC(=C2C(=C1)C=CC=N2)N.Br
Found 2 products.