CymitQuimica logo

CAS 312694-02-3

:

6-[2-propyl-4-(4-pyridylazo)phenoxy]hexanoic acid

Description:
6-[2-Propyl-4-(4-pyridylazo)phenoxy]hexanoic acid, identified by its CAS number 312694-02-3, is a synthetic organic compound characterized by its complex structure, which includes a hexanoic acid moiety linked to a phenoxy group that is further substituted with a pyridylazo group. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to its dual functional groups, making it potentially useful in various applications, including as a ligand in coordination chemistry or as a dye in analytical chemistry. The presence of the pyridylazo group suggests that it may exhibit chromogenic properties, allowing it to change color in response to pH or metal ion interactions. Additionally, the propyl and hexanoic acid chains contribute to its solubility characteristics, influencing its behavior in different solvents. Overall, this compound's unique structural features may enable it to participate in diverse chemical reactions and applications, particularly in fields such as materials science, biochemistry, and analytical chemistry.
Formula:C20H25N3O3
InChI:InChI=1/C20H25N3O3/c1-2-6-16-15-18(23-22-17-10-12-21-13-11-17)8-9-19(16)26-14-5-3-4-7-20(24)25/h8-13,15H,2-7,14H2,1H3,(H,24,25)
InChI key:RKSDFQDWVOJLAU-UHFFFAOYSA-N
SMILES:CCCc1cc(ccc1OCCCCCC(=O)O)N=Nc1ccncc1
Synonyms:
  • 6-[2-Propyl-4-(pyridin-4-yldiazenyl)phenoxy]hexanoic acid
Found 4 products.