CAS 3127-08-0

Bis(hydroxymethyl)phenylphosphine

Description:

Bis(hydroxymethyl)phenylphosphine, with the CAS number 3127-08-0, is an organophosphorus compound characterized by the presence of a phenyl group and two hydroxymethyl substituents attached to a phosphorus atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its role as a ligand in coordination chemistry, where it can form complexes with various metal ions, enhancing catalytic processes. The hydroxymethyl groups contribute to its solubility in polar solvents and can participate in hydrogen bonding, influencing its reactivity and interactions with other chemical species. Additionally, the presence of the phosphorus atom imparts unique properties, such as potential applications in organic synthesis and materials science. Safety considerations should be taken into account, as organophosphorus compounds can exhibit toxicity, and appropriate handling procedures are recommended. Overall, bis(hydroxymethyl)phenylphosphine is a versatile compound with significant implications in both academic research and industrial applications.

Formula: C₈H₁₁O₂P

InChI: InChI=1S/C8H11O2P/c9-6-11(7-10)8-4-2-1-3-5-8/h1-5,9-10H,6-7H2

InChI key: InChIKey=LJDGKIUMGVMSGI-UHFFFAOYSA-N

SMILES: P(CO)(CO)C1=CC=CC=C1

Synonyms:

• 1,1′-(Phenylphosphinidene)bis[methanol]
• Bis(hydroxymethyl)phenylphosphine
• Methanol, (phenylphosphinidene)bis-
• Methanol, 1,1′-(phenylphosphinidene)bis-
• Methanol, (phenylphosphinidene)di-

BIS(HYDROXYMETHYL)PHENYLPHOSPHINE

CAS: 3127-08-0

Formula: C₈H₁₁O₂P

Molecular weight: 170.1455

Ref: IN-DA003OB5