CymitQuimica logo

CAS 31270-81-2

:

4-chloro-2-methylfuro[3,2-c]pyridine

Description:
4-Chloro-2-methylfuro[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused ring structure, which includes both a furan and a pyridine moiety. This compound features a chlorine atom and a methyl group attached to the aromatic system, influencing its chemical reactivity and physical properties. Typically, it appears as a solid at room temperature and may exhibit a range of colors depending on purity and specific conditions. The presence of the chlorine atom can enhance its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility and stability can vary based on the solvent and environmental conditions, which are important considerations for its practical applications. Overall, 4-chloro-2-methylfuro[3,2-c]pyridine is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C8H6ClNO
InChI:InChI=1S/C8H6ClNO/c1-5-4-6-7(11-5)2-3-10-8(6)9/h2-4H,1H3
InChI key:LRXMMHCYTFNTEL-UHFFFAOYSA-N
SMILES:CC1=CC2=C(O1)C=CN=C2Cl
Found 1 products.