CAS 312746-71-7
:D-S-Isoamylcysteine
Description:
D-S-Isoamylcysteine is a sulfur-containing amino acid derivative characterized by its unique structure, which includes an isoamyl group attached to the cysteine backbone. This compound is notable for its potential applications in various fields, including biochemistry and pharmaceuticals. It exhibits properties typical of amino acids, such as the ability to form peptide bonds and participate in protein synthesis. The presence of the thiol (-SH) group in cysteine allows for redox reactions and the formation of disulfide bonds, which are crucial for protein folding and stability. D-S-Isoamylcysteine may also exhibit antioxidant properties, contributing to cellular protection against oxidative stress. Its specific stereochemistry, indicated by the "D-" prefix, suggests that it is the dextrorotatory form of isoamylcysteine, which can influence its biological activity and interactions with enzymes and receptors. Overall, D-S-Isoamylcysteine is of interest for its biochemical roles and potential therapeutic applications, although further research is needed to fully elucidate its mechanisms and effects.
Formula:C8H17NO2S
InChI:InChI=1/C8H17NO2S/c1-6(2)3-4-12-5-7(9)8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m1/s1
InChI key:RZKQYQDZHWKJKY-LURJTMIESA-N
SMILES:CCC(C)(C)SC[C@@H](C(=O)O)N
Synonyms:- (R)-2-Amino-3-(St-isoamylthio)propanoic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
