CymitQuimica logo

CAS 3128-15-2

:

cyclopent-1-ene-1,2-dicarboxylic acid

Description:
Cyclopent-1-ene-1,2-dicarboxylic acid, with the CAS number 3128-15-2, is an organic compound characterized by its cyclopentene ring structure, which features two carboxylic acid functional groups attached to the first and second carbon atoms of the ring. This compound is a colorless to pale yellow liquid at room temperature and is known for its relatively low volatility. It exhibits typical properties of dicarboxylic acids, including the ability to form hydrogen bonds, which contributes to its solubility in polar solvents like water and alcohols. The presence of the double bond in the cyclopentene structure makes it reactive, particularly in addition reactions. Cyclopent-1-ene-1,2-dicarboxylic acid can be used in various chemical syntheses and may serve as a precursor for more complex organic molecules. Its unique structure and functional groups also make it of interest in materials science and polymer chemistry, where it can be utilized in the development of new materials with specific properties.
Formula:C7H8O4
InChI:InChI=1/C7H8O4/c8-6(9)4-2-1-3-5(4)7(10)11/h1-3H2,(H,8,9)(H,10,11)
InChI key:JDHOCWRIAQDGEY-UHFFFAOYSA-N
SMILES:C1CC(=C(C1)C(=O)O)C(=O)O
Found 3 products.