CAS 31281-88-6

8-Indoadenosine

Description:

8-Indoadenosine, with the CAS number 31281-88-6, is a purine nucleoside derivative that features an indole moiety attached to the adenine structure. This compound is characterized by its unique structural configuration, which combines the properties of both indole and adenosine. It typically exhibits biological activity, particularly in the context of cellular signaling and neurotransmission, due to its ability to interact with adenosine receptors. The presence of the indole group may also impart additional pharmacological properties, potentially influencing its role in various biochemical pathways. 8-Indoadenosine is soluble in polar solvents, and its stability can be affected by environmental conditions such as pH and temperature. As a research compound, it is often studied for its potential therapeutic applications, including neuroprotective effects and modulation of immune responses. Overall, 8-Indoadenosine represents a fascinating intersection of purine chemistry and biological activity, making it a subject of interest in medicinal chemistry and pharmacology.

Formula: C10H12IN5O4

InChI: InChI=1S/C10H12IN5O4/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,13,14)/t3-,5-,6-,9-/m1/s1

InChI key: CYOIMLAHGVOKIG-UUOKFMHZSA-N

SMILES: C1=NC(=C2C(=N1)N(C(=N2)I)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N

(2R,3R,4S,5R)-2-(6-Amino-8-iodo-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

CAS: 31281-88-6

(2R,3R,4S,5R)-2-(6-Amino-8-iodo-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

Formula: C₁₀H₁₂IN₅O₄

Purity: 97%

Molecular weight: 393.14

Ref: 54-OR1038456

8-Iodoadenosine

CAS: 31281-88-6

Formula: C₁₀H₁₂IN₅O₄

Purity: 97%

Molecular weight: 393.1378

Ref: IN-DA00CL28

(2R,3R,4S,5R)-2-(6-Amino-8-iodo-9H-purin-9-yl)-5-(hydroxymethyl)tetrahydrofuran-3,4-diol

CAS: 31281-88-6

Purity: 97%

Molecular weight: 393.1409912

Ref: 10-F605787

8-Iodoadenosine

CAS: 31281-88-6

8-Iodoadenosine is a macrocyclic inhibitor that binds to the phosphate group on ATP. This binding prevents ATP from being hydrolyzed to ADP and inorganic phosphate, which inhibits the formation of ATP. 8-Iodoadenosine has been shown to inhibit the proliferation of some cancer cells by interfering with their ability to synthesize proteins. It has also been shown to be an effective treatment for parasitic infections caused by Entamoeba histolytica. 8-Iodoadenosine has also been shown to inhibit protein synthesis in bacteria, fungi, and parasites.

Formula: C₁₀H₁₂IN₅O₄

Purity: Min. 95%

Molecular weight: 393.14 g/mol

Ref: 3D-NI36298