CymitQuimica logo

CAS 31295-66-6

:

4-iodo-5-methyl-3-phenylisoxazole

Description:
4-Iodo-5-methyl-3-phenylisoxazole is a heterocyclic organic compound characterized by its isoxazole ring, which contains both nitrogen and oxygen atoms. The presence of the iodine atom at the 4-position and a methyl group at the 5-position contributes to its unique reactivity and physical properties. The phenyl group at the 3-position enhances its aromatic character, potentially influencing its solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. The compound's stability, reactivity, and interaction with biological systems can be influenced by the substituents on the isoxazole ring. As with many organic compounds, its properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Proper handling and safety measures should be observed due to the presence of iodine, which can be hazardous in certain concentrations.
Formula:C10H8INO
InChI:InChI=1/C10H8INO/c1-7-9(11)10(12-13-7)8-5-3-2-4-6-8/h2-6H,1H3
InChI key:DDVPBKUHWSZYIP-UHFFFAOYSA-N
SMILES:Cc1c(c(c2ccccc2)no1)I
Found 2 products.