CAS 3131-03-1
:N-{22-[4-(dimethylamino)benzyl]-6-ethyl-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyldocosahydro-12H-pyrido[2,1-f]pyrrolo[2,1-l][1,4,7,10,13,16]oxapentaazacyclononadecin-9-yl}-3-hydroxypyridine-2-carboxamide
Description:
The chemical substance N-{22-[4-(dimethylamino)benzyl]-6-ethyl-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyldocosahydro-12H-pyrido[2,1-f]pyrrolo[2,1-l][1,4,7,10,13,16]oxapentaazacyclononadecin-9-yl}-3-hydroxypyridine-2-carboxamide, with CAS number 3131-03-1, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and a significant degree of molecular complexity. This substance features a pyridine ring, which is known for its aromatic properties, and a carboxamide group that contributes to its potential solubility and reactivity. The presence of dimethylamino and ethyl groups suggests that it may exhibit specific electronic and steric properties, influencing its biological activity. Additionally, the heptaoxo and multi-cyclic components indicate potential applications in medicinal chemistry, possibly as a pharmaceutical agent. Its structural complexity may also imply unique interactions with biological targets, making it a subject of interest in drug development and research. However, detailed studies would be necessary to fully understand its properties and potential applications.
Formula:C45H54N8O10
InChI:InChI=1/C45H54N8O10/c1-6-31-42(59)52-22-11-14-32(52)43(60)51(5)34(24-27-16-18-29(19-17-27)50(3)4)44(61)53-23-20-30(54)25-33(53)39(56)49-37(28-12-8-7-9-13-28)45(62)63-26(2)36(40(57)47-31)48-41(58)38-35(55)15-10-21-46-38/h7-10,12-13,15-19,21,26,31-34,36-37,55H,6,11,14,20,22-25H2,1-5H3,(H,47,57)(H,48,58)(H,49,56)/t26?,31?,32?,33?,34-,36?,37?/m0/s1
SMILES:CCC1C(=O)N2CCCC2C(=O)N(C)[C@@H](Cc2ccc(cc2)N(C)C)C(=O)N2CCC(=O)CC2C(=NC(c2ccccc2)C(=O)OC(C)C(C(=N1)O)N=C(c1c(cccn1)O)O)O
Synonyms:- 2-pyridinecarboxamide, N-[22-[[4-(dimethylamino)phenyl]methyl]-6-ethyldocosahydro-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyl-12H-pyrido[2,1-f]pyrrolo[2,1-l][1,4,7,10,13,16]oxapentaazacyclononadecin-9-yl]-3-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pristinamycin IA
CAS:Pristinamycin IA is a streptogramin antibiotic, which is a natural product derived from the bacterium *Streptomyces pristinaespiralis*. It operates by inhibiting bacterial protein synthesis through the disruption of ribosomal function, specifically targeting the 50S ribosomal subunit. This mode of action is effective in halting bacterial growth, making it particularly significant in combating resistant strains.
Formula:C45H54N8O10Purity:Min. 95%Molecular weight:866.96 g/molPristinamycin IA
CAS:Pristinamycin IA (Mikamycin B) is a substrate for the P-glycoprotein and a cyclo-peptidic macrolactone antibiotic.Formula:C45H54N8O10Purity:97.44%Color and Shape:SolidMolecular weight:866.96




