CymitQuimica logo

CAS 313545-20-9

:

3-Chloro-2-methylbenzeneboronic acid

Description:
3-Chloro-2-methylbenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a chlorinated aromatic ring. This compound features a chlorinated benzene ring with a methyl substituent at the 2-position and a boronic acid group at the 3-position. It is typically a white to off-white solid that is soluble in polar organic solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the chlorine atom can influence the reactivity and electronic properties of the compound, potentially enhancing its utility in various applications. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor technology and drug delivery systems. Overall, 3-Chloro-2-methylbenzeneboronic acid is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C7H8BClO2
InChI:InChI=1/C7H8BClO2/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,10-11H,1H3
InChI key:BJPNVVXTUYMJPN-UHFFFAOYSA-N
SMILES:Cc1c(cccc1Cl)B(O)O
Synonyms:
  • (3-Chloro-2-methylphenyl)boronic acid
  • boronic acid, B-(3-chloro-2-methylphenyl)-
Found 5 products.