CymitQuimica logo

CAS 313654-83-0

:

tert-butyl 4-(3-chloropyrazin-2-yl)piperazine-1-carboxylate

Description:
Tert-butyl 4-(3-chloropyrazin-2-yl)piperazine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a tert-butyl group, a piperazine ring, and a chloropyrazine moiety. This compound typically exhibits properties associated with both piperazine derivatives and halogenated heterocycles, such as moderate solubility in organic solvents and potential bioactivity due to its structural features. The presence of the chloropyrazine group may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the tert-butyl ester functionality can influence the compound's lipophilicity and stability. As with many piperazine derivatives, this compound may interact with various biological targets, which could be explored for therapeutic applications. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C13H19ClN4O2
InChI:InChI=1/C13H19ClN4O2/c1-13(2,3)20-12(19)18-8-6-17(7-9-18)11-10(14)15-4-5-16-11/h4-5H,6-9H2,1-3H3
InChI key:IJINSJSWDSHUBL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)c1c(Cl)nccn1
Synonyms:
  • tert-Butyl-4-(3-chlorpyrazin-2-yl)piperazin-1-carboxylat
Found 3 products.