CymitQuimica logo

CAS 31401-46-4

:

N,N-Dimethyl-5-pyrimidinamine

Description:
N,N-Dimethyl-5-pyrimidinamine, with the CAS number 31401-46-4, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at the 1 and 3 positions. This compound features two methyl groups attached to the nitrogen atom at the 4 position of the pyrimidine ring, contributing to its basicity and solubility in polar solvents. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. N,N-Dimethyl-5-pyrimidinamine is known for its applications in the synthesis of pharmaceuticals and agrochemicals, serving as an intermediate in various chemical reactions. Its basicity allows it to participate in nucleophilic substitutions and other reactions typical of amines. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling. Overall, this compound is significant in organic synthesis and medicinal chemistry due to its structural properties and reactivity.
Formula:C6H9N3
InChI:InChI=1S/C6H9N3/c1-9(2)6-3-7-5-8-4-6/h3-5H,1-2H3
InChI key:InChIKey=JWVNPUBYKCSIKR-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C=NC=NC1
Synonyms:
  • 5-Pyrimidinamine, N,N-dimethyl-
  • N,N-Dimethyl-5-pyrimidinamine
  • 5-(Dimethylamino)pyrimidine
  • Pyrimidine, 5-(dimethylamino)-
Found 3 products.