CAS 314041-08-2
:Ellagic acid hydrate
Description:
Ellagic acid hydrate, with the CAS number 314041-08-2, is a naturally occurring polyphenolic compound found in various fruits and vegetables, particularly in berries, pomegranates, and nuts. It is known for its antioxidant properties, which help neutralize free radicals and may contribute to various health benefits, including anti-inflammatory and anticancer effects. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its solubility and stability. Ellagic acid itself is characterized by its ability to form complexes with metal ions and its potential to modulate various biological pathways. In terms of physical properties, ellagic acid hydrate typically appears as a white to off-white powder, and it is soluble in organic solvents like ethanol and dimethyl sulfoxide, but less soluble in water. Its applications extend beyond nutrition, as it is also explored in pharmaceuticals and cosmetics for its beneficial properties. Overall, ellagic acid hydrate is a compound of significant interest in both nutritional science and medicinal chemistry.
Formula:C14H8O9
InChI:InChI=1/C14H6O8.H2O/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19;/h1-2,15-18H;1H2
SMILES:c1c2c3c4c(cc(c(c4oc2=O)O)O)c(=O)oc3c(c1O)O.O
Synonyms:- [1]Benzopyrano[5,4,3-Cde][1]Benzopyran-5,10-Dione, 2,3,7,8-Tetrahydroxy-, Hydrate (1:1)
- 2,3,7,8-Tetrahydroxychromeno[5,4,3-cde]chromene-5,10-dione hydrate (1:1)
- 2,3,7,8-Tetrahydroxychromeno[5,4,3-Cde]Chromene-5,10-Dione Hydrate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3,7,8-Tetrahydroxychromeno[5,4,3-Cde]Chromene-5,10-Dione Hydrate
CAS:2,3,7,8-Tetrahydroxychromeno[5,4,3-Cde]Chromene-5,10-Dione HydrateFormula:C14H8O9Purity:≥95%Molecular weight:320.21Ellagic acid (hydrate)
CAS:Ellagic acid (hydrate) is a natural antioxidant and acts as a potent and ATP-competitive CK2 inhibitor (IC50:40 nM, Ki: 20 nM).Formula:C14H8O9Purity:98%Color and Shape:SolidMolecular weight:320.21Ellagic acid hydrate
CAS:Derived from berries and grapes; anti-oxidant; anti-proliferativeFormula:C14H6O8·xH2OPurity:Min. 95%Color and Shape:PowderMolecular weight:302.19 g/mol




