CymitQuimica logo

CAS 31410-07-8

:

3-methyl-1-(prop-2-en-1-yl)-1H-imidazol-3-ium bromide

Description:
3-Methyl-1-(prop-2-en-1-yl)-1H-imidazol-3-ium bromide is an organic compound characterized by its imidazolium structure, which features a five-membered aromatic ring containing nitrogen atoms. This compound is a salt, with the bromide ion serving as the counterion to the positively charged imidazolium cation. The presence of the methyl and prop-2-en-1-yl substituents contributes to its unique reactivity and solubility properties. Typically, imidazolium salts are known for their role in various applications, including as ionic liquids, catalysts, and in organic synthesis. The compound exhibits good thermal stability and can be soluble in polar solvents, making it useful in various chemical reactions. Additionally, its structure allows for potential applications in materials science and medicinal chemistry, particularly in the development of new pharmaceuticals or functional materials. Overall, 3-methyl-1-(prop-2-en-1-yl)-1H-imidazol-3-ium bromide is a versatile compound with significant potential in both academic and industrial chemistry.
Formula:C7H11BrN2
InChI:InChI=1/C7H11N2.BrH/c1-3-4-9-6-5-8(2)7-9;/h3,5-7H,1,4H2,2H3;1H/q+1;/p-1
InChI key:KLFDZFIZKMEUGI-UHFFFAOYSA-M
SMILES:C[N+]1=CN(C=C1)CC=C.[Br-]
Synonyms:
  • 1H-imidazolium, 1-methyl-3-(2-propen-1-yl)-, bromide (1:1)
  • 1-methyl-3-(prop-2-en-1-yl)-1H-imidazol-3-ium bromide
  • 1-Allyl-3-methylimidazolium bromide
Found 7 products.