CAS 314728-85-3
:1-(4-Benzoyl-1-piperazinyl)-1-propanone
Description:
1-(4-Benzoyl-1-piperazinyl)-1-propanone, identified by its CAS number 314728-85-3, is a chemical compound that features a piperazine ring substituted with a benzoyl group and a propanone moiety. This compound typically exhibits characteristics common to piperazine derivatives, such as potential psychoactive properties and the ability to interact with various biological targets. It is often studied for its pharmacological applications, particularly in the fields of medicinal chemistry and drug development. The presence of the benzoyl group may enhance lipophilicity, influencing its solubility and permeability across biological membranes. Additionally, the ketone functional group in the propanone structure can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Safety and handling precautions are essential when working with this compound, as with many synthetic organic chemicals, due to potential toxicity and reactivity. Overall, 1-(4-Benzoyl-1-piperazinyl)-1-propanone represents a significant compound for research in pharmacology and organic synthesis.
Formula:C14H18N2O2
InChI:InChI=1S/C14H18N2O2/c1-2-13(17)15-8-10-16(11-9-15)14(18)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3
InChI key:InChIKey=DGOWDUFJCINDGI-UHFFFAOYSA-N
SMILES:C(=O)(N1CCN(C(CC)=O)CC1)C2=CC=CC=C2
Synonyms:- 1-(4-Benzoyl-1-piperazinyl)-1-propanone
- 1-Benzoyl-4-(1-oxopropyl)piperazine
- 1-Propanone, 1-(4-benzoyl-1-piperazinyl)-
- Dm-235
- Piperazine, 1-benzoyl-4-(1-oxopropyl)-
- Sunifiram
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Ref: IN-DA007J5C
500mgTo inquire250mg23.00€1g27.00€5g55.00€5mg95.00€10mg122.00€25g128.00€25mg176.00€50mg262.00€100mg497.00€200mg553.00€1-(4-Benzoylpiperazin-1-Yl)Propan-1-One
CAS:1-(4-Benzoylpiperazin-1-Yl)Propan-1-OneFormula:C14H18N2O2Purity:98%Molecular weight:246.3Sunifiram
CAS:Sunifiram (DM-235) is a potent nootropic agent.Formula:C14H18N2O2Purity:99.57%Color and Shape:White SolidMolecular weight:246.3Sunifiram
CAS:Sunifiram is a piperazine-based nootropic drug that acts as a cognitive enhancer. It has been shown to act as an allosteric modulator at the synaptic and hippocampal Ca1 and C1-6 alkyl receptors, thereby inhibiting acetylcholinesterase and enhancing cholinergic transmission. Sunifiram also has been shown to have antidepressant effects in animal models of depression. Sunifiram has not been shown to be toxic to long-term use or behavioral therapy, making it a potential candidate for treatment of Alzheimer 's disease. However, there is little evidence for its efficacy in this area.
Formula:C14H18N2O2Purity:Min. 95%Molecular weight:246.31 g/mol








