CAS 315-12-8
:5-Fluoro-1,3-dimethyl-2-nitrobenzene
Description:
5-Fluoro-1,3-dimethyl-2-nitrobenzene is an aromatic compound characterized by the presence of a nitro group, a fluorine atom, and two methyl groups attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the 2-position, a fluorine atom at the 5-position, and methyl groups at the 1 and 3 positions of the benzene ring. This compound is typically a yellow to brown solid at room temperature and is known for its moderate solubility in organic solvents. It exhibits distinct chemical reactivity due to the electron-withdrawing nature of the nitro and fluorine substituents, which can influence its electrophilic substitution reactions. Additionally, the presence of these functional groups can affect its physical properties, such as melting and boiling points, as well as its stability under various conditions. 5-Fluoro-1,3-dimethyl-2-nitrobenzene is utilized in various chemical syntheses and research applications, particularly in the field of pharmaceuticals and agrochemicals.
Formula:C8H8FNO2
InChI:InChI=1/C8H8FNO2/c1-5-3-7(9)4-6(2)8(5)10(11)12/h3-4H,1-2H3
SMILES:Cc1cc(cc(C)c1N(=O)=O)F
Synonyms:- 5-Fluoro-2-nitro-m-xylene
- Benzene, 5-fluoro-1,3-dimethyl-2-nitro-
- 2,6-Dimethyl-4-fluoronitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Fluoro-1,3-dimethyl-2-nitrobenzene, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H8FNO2Purity:98%Color and Shape:White to pale yellow, Crystals or powder or crystalline powderMolecular weight:169.165-Fluoro-1,3-dimethyl-2-nitrobenzene
CAS:5-Fluoro-1,3-dimethyl-2-nitrobenzeneFormula:C8H8FNO2Purity:98%Color and Shape:Solid-CrystalsMolecular weight:169.153025-Fluoro-1,3-dimethyl-2-nitrobenzene
CAS:Formula:C8H8FNO2Purity:98%Color and Shape:SolidMolecular weight:169.15305-Fluoro-1,3-dimethyl-2-nitrobenzene
CAS:Formula:C8H8FNO2Purity:96%Color and Shape:SolidMolecular weight:169.155




