CymitQuimica logo

CAS 3153-01-3

:

Benzoic acid, 2,3,5,6-tetrafluoro-4-methoxy-

Description:
Benzoic acid, 2,3,5,6-tetrafluoro-4-methoxy- (CAS 3153-01-3) is a fluorinated aromatic carboxylic acid characterized by the presence of four fluorine atoms and a methoxy group attached to a benzoic acid structure. The fluorine substituents significantly influence its chemical properties, enhancing its lipophilicity and altering its acidity compared to non-fluorinated benzoic acids. The methoxy group contributes to the compound's overall polarity and can affect its solubility in various solvents. This compound is typically solid at room temperature and may exhibit a crystalline structure. Its unique combination of functional groups makes it of interest in various applications, including pharmaceuticals, agrochemicals, and materials science. The presence of fluorine can also impart unique reactivity and stability characteristics, making it a valuable compound for research and industrial applications. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit different toxicological profiles compared to their non-fluorinated counterparts.
Formula:C8H4F4O3
InChI:InChI=1S/C8H4F4O3/c1-15-7-5(11)3(9)2(8(13)14)4(10)6(7)12/h1H3,(H,13,14)
InChI key:MWSDDXXQRTVVDO-UHFFFAOYSA-N
SMILES:COC1=C(C(=C(C(=C1F)F)C(=O)O)F)F
Synonyms:
  • 2,3,5,6-Tetrafluoro-4-methoxybenzoic acid
Found 4 products.