
CAS 315698-36-3
:MLS1547
Description:
MLS1547, with the CAS number 315698-36-3, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential as a therapeutic agent. It is characterized as a small molecule inhibitor, specifically targeting certain protein kinases involved in various cellular processes. The compound is typically evaluated for its efficacy in inhibiting cancer cell proliferation and may exhibit selectivity towards specific cancer types. Its molecular structure includes functional groups that contribute to its biological activity, and it is often assessed for solubility, stability, and bioavailability in pharmacological studies. Additionally, MLS1547 may undergo various forms of testing to determine its safety profile and potential side effects in preclinical and clinical settings. As research progresses, the compound's role in drug development and its mechanism of action continue to be explored, highlighting its significance in the search for novel cancer therapies.
Formula:C19H19ClN4O
InChI:InChI=1S/C19H19ClN4O/c20-16-12-14(19(25)18-15(16)4-3-7-22-18)13-23-8-10-24(11-9-23)17-5-1-2-6-21-17/h1-7,12,25H,8-11,13H2
InChI key:OPEJNANYABTIGC-UHFFFAOYSA-N
SMILES:C1CN(CCN1CC2=CC(=C3C=CC=NC3=C2O)Cl)C4=CC=CC=N4
Synonyms:- 8-Quinolinol, 5-chloro-7-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-
- Inhibitor,inhibit,biased,β-arrestin,MLS1547,Dopamine Receptor,protein,signaling,recruitment
- MLS000051547
- MLS1547 >=98% (HPLC)
- MLS1547
- 5-Chloro-7-[[4-(2-pyridinyl)-1-piperazinyl]methyl]-8-quinolinol
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5-Chloro-7-((4-(pyridin-2-yl)piperazin-1-yl)methyl)quinolin-8-ol
CAS:Formula:C19H19ClN4OPurity:98%Molecular weight:354.8334MLS1547
CAS:5-Chloro-7-((4-(pyridin-2-yl)piperazin-1-yl)methyl)quinolin-8-olFormula:C19H19ClN4OPurity:98%Molecular weight:354.83MLS 1547
CAS:MLS 1547 is a selective D2 dopamine receptor agonist that was designed to have a high degree of selectivity for the D2 receptor subtype. MLS 1547 has low expression in cells and tissues, which may be due to its lack of hydroxyl groups. The agonist binding site on the D2 receptor is located at the extracellular end, and this drug interacts with it to suppress tumour growth. MLS 1547 also binds to other dopamine receptors and can inhibit tyrosine hydroxylase activity, leading to reduced dopamine synthesis and release. This compound also inhibits the proliferation of cancer cells by suppressing cellular proliferation in the extracellular space.Formula:C19H19ClN4OPurity:Min. 95%Molecular weight:354.83 g/molMLS1547
CAS:MLS1547 is a potent D2 receptor G protein-biased agonist (Ki=1.2 μM, EC50=0.37 μM in Ca2+ assay).Formula:C19H19ClN4OPurity:99.64%Color and Shape:SolidMolecular weight:354.833




