CymitQuimica logo

CAS 315703-52-7

:

2-Thiazolamine,N-(4-ethoxyphenyl)-4-(2-methylimidazo[1,2-a]pyridin-3-yl)-

Description:
2-Thiazolamine, N-(4-ethoxyphenyl)-4-(2-methylimidazo[1,2-a]pyridin-3-yl)- is a chemical compound characterized by its complex structure, which includes a thiazole ring, an ethoxyphenyl group, and an imidazo[1,2-a]pyridine moiety. This compound is likely to exhibit properties typical of heterocyclic amines, such as potential biological activity, which may include antimicrobial or anticancer effects, given the presence of the imidazo and thiazole rings known for their pharmacological significance. The ethoxy group may enhance solubility and bioavailability. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's CAS number, 315703-52-7, allows for its identification in chemical databases, facilitating research and development in medicinal chemistry. As with many synthetic organic compounds, safety data, including toxicity and handling precautions, should be reviewed before use in laboratory or industrial settings.
Formula:C19H18 N4 O S
InChI:InChI=1S/C19H18N4OS/c1-3-24-15-9-7-14(8-10-15)21-19-22-16(12-25-19)18-13(2)20-17-6-4-5-11-23(17)18/h4-12H,3H2,1-2H3,(H,21,22)
InChI key:ROYXIPOUVGDTAO-UHFFFAOYSA-N
SMILES:CCOC1=CC=C(C=C1)NC2=NC(=CS2)C3=C(N=C4N3C=CC=C4)C
Synonyms:
  • Jk184
Found 7 products.