CymitQuimica logo

CAS 317830-83-4

:

1-Benzofuran-3-ylboronic acid

Description:
1-Benzofuran-3-ylboronic acid is an organic compound characterized by the presence of a benzofuran moiety and a boronic acid functional group. Its molecular structure features a fused benzene and furan ring, which contributes to its aromatic properties and potential reactivity. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in biological and chemical processes. Additionally, 1-benzofuran-3-ylboronic acid can participate in Suzuki coupling reactions, a widely used method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Its unique structural features and reactivity profile make it a significant compound in the development of pharmaceuticals and agrochemicals.
Formula:C8H7BO3
InChI:InChI=1/C8H7BO3/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5,10-11H
InChI key:DFUGYZQSDFQVPU-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(co2)B(O)O
Synonyms:
  • boronic acid, B-3-benzofuranyl-
  • Benzofuran-3-Boronic Acid
  • 3-Benzofuranylboronic acid
Found 6 products.