CAS 317830-83-4
:1-Benzofuran-3-ylboronic acid
Description:
1-Benzofuran-3-ylboronic acid is an organic compound characterized by the presence of a benzofuran moiety and a boronic acid functional group. Its molecular structure features a fused benzene and furan ring, which contributes to its aromatic properties and potential reactivity. The boronic acid group (-B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, which enhances its utility in biological and chemical processes. Additionally, 1-benzofuran-3-ylboronic acid can participate in Suzuki coupling reactions, a widely used method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Its unique structural features and reactivity profile make it a significant compound in the development of pharmaceuticals and agrochemicals.
Formula:C8H7BO3
InChI:InChI=1/C8H7BO3/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5,10-11H
SMILES:c1ccc2c(c1)c(co2)B(O)O
Synonyms:- boronic acid, B-3-benzofuranyl-
- Benzofuran-3-Boronic Acid
- 3-Benzofuranylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzofuran-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H7BO3Purity:97.0 to 113.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:161.95Benzo[b]furan-3-boronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H7BO3Purity:98%Molecular weight:161.95Benzofuran-3-ylboronic acid
CAS:Formula:C8H7BO3Purity:98%Color and Shape:SolidMolecular weight:161.9504Benzofuran-3-boronic acid
CAS:Benzofuran-3-boronic acidFormula:C8H7BO3Purity:98%Color and Shape:SolidMolecular weight:161.95038Benzofuran-3-ylboronic acid
CAS:Formula:C8H7BO3Purity:98%Color and Shape:Solid, Very pale yellow - Pale reddish yellow powderMolecular weight:161.95




