CAS 31785-68-9

9-Azabicyclo[3.3.1]non-9-yloxy

Description:

9-Azabicyclo[3.3.1]non-9-yloxy, with the CAS number 31785-68-9, is a bicyclic compound featuring a nitrogen atom within its ring structure, which classifies it as a bicyclic amine. This compound is characterized by its unique bicyclic framework, consisting of a nonane backbone with a nitrogen atom incorporated into one of the rings. The presence of the "9-yloxy" group indicates that there is an ether functional group attached to the bicyclic structure, which can influence its reactivity and solubility. Generally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. They can participate in various chemical reactions due to the presence of the nitrogen atom, which can act as a nucleophile or a base. Additionally, the steric and electronic properties of the bicyclic structure can affect the compound's interactions with biological targets. Overall, 9-Azabicyclo[3.3.1]non-9-yloxy is a compound with potential applications in drug development and organic synthesis.

Formula: C₈H₁₄NO

InChI: InChI=1S/C8H15NO/c10-9-7-3-1-4-8(9)6-2-5-7/h7-8,10H,1-6H2

InChI key: WUXMSJQQHBZNIK-UHFFFAOYSA-N

SMILES: C1CC2CCCC(C1)N2O

Synonyms:

• exe-3-methylamino-9-boc -9-azabicyclo[3.3.1]nonane

9-Azabicyclo[3.3.1]Nonane N-Oxyl

CAS: 31785-68-9

9-Azabicyclo[3.3.1]Nonane N-Oxyl

Formula: C₈H₁₄NO

Purity: >95%

Color and Shape: Solid

Molecular weight: 140.2

Ref: 54-OR1012149

9-Azabicyclo[3.3.1]nonane n-oxyl

CAS: 31785-68-9

Formula: C₈H₁₄NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 140.2029

Ref: IN-DA00CMZN

9-Azabicyclo[3.3.1]nonane n-oxyl

CAS: 31785-68-9

9-Azabicyclo[3.3.1]nonane n-oxyl

Formula: C₈H₁₄NO

Purity: 98%

Molecular weight: 140.2

Ref: IN-DG01106193

9-Azabicyclo[3.3.1]nonane N-oxyl

CAS: 31785-68-9

9-Azabicyclo[3.3.1]nonane N-oxyl (ABNO) is a reaction component in copper catalysed aerobic oxidation of alcohols. ABNO is a less hindered nitroxyl radical that exhibits an enhanced reactivity compared with TEMPO. Low catalyst loading (1 mol%) of ABNO can efficiently catalyse oxidation of alcohols in the presence of a Cu+ species and atmospheric oxygen to give the corresponding aldehyde or ketone.

Formula: C₈H₁₄NO

Purity: Min. 95 Area-%

Color and Shape: Powder

Molecular weight: 140.2 g/mol

Ref: 3D-FA59534

9-Azabicyclo[3.3.1]nonane n-oxyl

CAS: 31785-68-9

Formula: C₈H₁₅NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 141.214

Ref: 10-F549701

9-hydroxy-9-azabicyclo[3.3.1]nonane

CAS: 31785-68-9

Purity: 98%

Color and Shape: Solid

Molecular weight: 141.2140045

Ref: 10-F874412