CymitQuimica logo

CAS 31827-04-0

:

methyl 3-hydroxy-1H-indole-2-carboxylate

Description:
Methyl 3-hydroxy-1H-indole-2-carboxylate, with the CAS number 31827-04-0, is an organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a hydroxyl group (-OH) at the 3-position and a carboxylate ester group (-COOCH3) at the 2-position, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. The presence of the hydroxyl group can enhance hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. Methyl 3-hydroxy-1H-indole-2-carboxylate may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can serve as a precursor for more complex indole derivatives. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in various analytical applications.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-14-10(13)8-9(12)6-4-2-3-5-7(6)11-8/h2-5,11-12H,1H3
InChI key:GHRXPKBLHFSXTB-UHFFFAOYSA-N
SMILES:COC(=O)c1c(c2ccccc2[nH]1)O
Synonyms:
  • 1H-indole-2-carboxylic acid, 3-hydroxy-, methyl ester
  • Methyl 3-hydroxy-1H-indole-2-carboxylate
Found 5 products.