CAS 31827-04-0
:methyl 3-hydroxy-1H-indole-2-carboxylate
Description:
Methyl 3-hydroxy-1H-indole-2-carboxylate, with the CAS number 31827-04-0, is an organic compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a hydroxyl group (-OH) at the 3-position and a carboxylate ester group (-COOCH3) at the 2-position, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. The presence of the hydroxyl group can enhance hydrogen bonding capabilities, influencing its solubility and interaction with biological systems. Methyl 3-hydroxy-1H-indole-2-carboxylate may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can serve as a precursor for more complex indole derivatives. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in various analytical applications.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-14-10(13)8-9(12)6-4-2-3-5-7(6)11-8/h2-5,11-12H,1H3
InChI key:GHRXPKBLHFSXTB-UHFFFAOYSA-N
SMILES:COC(=O)c1c(c2ccccc2[nH]1)O
Synonyms:- 1H-indole-2-carboxylic acid, 3-hydroxy-, methyl ester
- Methyl 3-hydroxy-1H-indole-2-carboxylate
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Methyl 3-hydroxyindole-2-carboxylate
CAS:Methyl 3-hydroxyindole-2-carboxylateFormula:C10H9NO3Purity:98%Molecular weight:191.18335Methyl 3-hydroxy-1H-indole-2-carboxylate
CAS:Formula:C10H9NO3Purity:98%Color and Shape:SolidMolecular weight:191.1834Methyl 3-hydroxy-1H-indole-2-carboxylate
CAS:Methyl 3-hydroxy-1H-indole-2-carboxylateFormula:C10H9NO3Purity:98%Molecular weight:191.183-Hydroxyindole-2-carboxylic acid methyl ester
CAS:3-Hydroxyindole-2-carboxylic acid methyl ester, an organic compound with CAS number [31827-04-0], is classified as an indole derivative - a type of heterocyclic organic compound. It has potential applications as a building block in organic synthesis as well as other areas such as in pharmaceutical and agrochemical industries due to its biological activity.Formula:C10H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:191.18 g/molMethyl 3-hydroxy-1H-indole-2-carboxylate
CAS:Formula:C10H9NO3Purity:98%Color and Shape:SolidMolecular weight:191.186




