CymitQuimica logo

CAS 31888-72-9

:

Picolinohydroxamic acid

Description:
Picolinohydroxamic acid, with the CAS number 31888-72-9, is an organic compound characterized by its hydroxamic acid functional group attached to a pyridine ring. This compound typically exhibits properties associated with both hydroxamic acids and pyridine derivatives, including potential chelating abilities due to the presence of the hydroxamic group, which can form stable complexes with metal ions. Picolinohydroxamic acid is often studied for its biological activity, particularly in the context of its potential as an inhibitor of certain enzymes, such as histone deacetylases, which play a role in gene regulation and cancer progression. The compound may also demonstrate solubility in polar solvents, reflecting the influence of its functional groups. Additionally, its structural features may contribute to its reactivity and interaction with various biological targets. Overall, picolinohydroxamic acid is of interest in medicinal chemistry and biochemistry for its potential therapeutic applications and its role in metal ion coordination chemistry.
Formula:C6H6N2O2
InChI:InChI=1S/C6H6N2O2/c9-6(8-10)5-3-1-2-4-7-5/h1-4,10H,(H,8,9)
InChI key:InChIKey=AWJLBFXUZYCIIH-UHFFFAOYSA-N
SMILES:C(NO)(=O)C1=CC=CC=N1
Synonyms:
  • N-Hydroxy-2-pyridinecarboxamide
  • Picolinohydroxamic acid
  • 2-Pyridinehydroxamic acid
  • 2-Pyridinecarboxamide, N-hydroxy-
  • Picolinylhydroxamic acid
Found 4 products.